Urolitīns B (1139-83-9) Ražotāja rūpnīca

Urolitīns B

Novembris 9, 2020

Urolitīns BSpecifications

nosaukums: Urolitīns B
Ķīmiskais nosaukums: 3-hidroksi-6H-dibenzo [b, d] piran-6-ona
CAS: 1139-83-9
Ķīmiskā formula: C13H8O3
Molekulārais svars: X
Krāsa:  Balts pulveris
InChi atslēga: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES kods: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Funkcija: Urolitīns B var uzlabot mitohondriju un muskuļu darbību.

Urolitīns B var uzlabot muskuļu spēku un izturību novecošanās laikā.

Pielietojums: Urolitīns B ir ellagitannis zarnu mikrobu metabolīts zarnās, un tam piemīt spēcīga antioksidanta un prooksidanta aktivitāte atkarībā no pārbaudes sistēmas un apstākļiem. Urolitīns B var parādīt arī estrogēnu un / vai antiestrogēnu aktivitāti.
Šķīdība: Viegli šķīst N, N-dimetilformamīdā un dimetilmetilēnā. Sulfons, nedaudz šķīst metanolā, etanolā un etilacetātā
Uzglabāšanas temperatūra: Higroskopisks, -20 ° C saldētava, Inertā atmosfērā
Piegādes nosacījums: Nosūtīts apkārtējā temperatūrā kā nebīstama ķīmiska viela. Šis produkts ir pietiekami stabils dažām nedēļām parastās kuģošanas laikā un Muitas laikā pavadītais laiks.